EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26O2 |
| Net Charge | 0 |
| Average Mass | 226.360 |
| Monoisotopic Mass | 226.19328 |
| SMILES | CC(C)CCC[C@H]1CC[C@@](C)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H26O2/c1-11(2)5-4-6-12-7-9-14(3,10-8-12)13(15)16/h11-12H,4-10H2,1-3H3,(H,15,16)/t12-,14+ |
| InChIKey | HARNFRANZLWZKO-XBXGTLAGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loxanast (CHEBI:752241) is a carboxylic acid (CHEBI:33575) |
| INN | Source |
|---|---|
| loxanast | WHO MedNet |