EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752226 - galdansetron hydrochloride
| Formula | HCl.C18H19N3O |
| Net Charge | 0 |
| Average Mass | 329.831 |
| Monoisotopic Mass | 329.12949 |
| SMILES | Cc1ncnc1C[C@H]1CCc2c(c3ccccc3n2C)C1=O.Cl |
| InChI | InChI=1S/C18H19N3O.ClH/c1-11-14(20-10-19-11)9-12-7-8-16-17(18(12)22)13-5-3-4-6-15(13)21(16)2;/h3-6,10,12H,7-9H2,1-2H3,(H,19,20);1H/t12-;/m1./s1 |
| InChIKey | OTQDHZWCXNUYMF-UTONKHPSSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galdansetron hydrochloride (CHEBI:752226) is a carbazoles (CHEBI:48513) |
| Synonyms | Source |
|---|---|
| Galdansetron hcl | ChEMBL |
| Galdansetron hydrochloride | ChEMBL |
| GR 81225C | ChEMBL |
| GR-81225C | ChEMBL |
| GR81225C | ChEMBL |
| GR-81225X | ChEMBL |