EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO6 |
| Net Charge | 0 |
| Average Mass | 325.361 |
| Monoisotopic Mass | 325.15254 |
| SMILES | COc1cc(OC)c(C(=O)OCCN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C16H23NO6/c1-19-12-10-13(20-2)15(14(11-12)21-3)16(18)23-9-6-17-4-7-22-8-5-17/h10-11H,4-9H2,1-3H3 |
| InChIKey | WXVNRHANVFMGDW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mofloverine (CHEBI:752203) is a methoxybenzoic acid (CHEBI:25238) |
| INNs | Source |
|---|---|
| mofloverina | WHO MedNet |
| mofloverine | WHO MedNet |