EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O8 |
| Net Charge | 0 |
| Average Mass | 534.690 |
| Monoisotopic Mass | 534.31927 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)CC[C@]4([H])C3=CC(=O)OC3)[C@@]1(C)CC[C@H](O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](OC)[C@@H]1O)C2 |
| InChI | InChI=1S/C30H46O8/c1-16-24(32)26(35-4)25(33)27(37-16)38-19-7-10-28(2)18(14-19)5-6-22-21(28)8-11-29(3)20(9-12-30(22,29)34)17-13-23(31)36-15-17/h13,16,18-22,24-27,32-34H,5-12,14-15H2,1-4H3/t16-,18+,19-,20+,21-,22+,24-,25-,26+,27-,28-,29+,30-/m0/s1 |
| InChIKey | VPUNMTHWNSJUOG-BAOINKAISA-N |
| Roles Classification |
|---|
| Biological Role: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| Applications: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neriifolin (CHEBI:7522) has functional parent digitoxigenin (CHEBI:42219) |
| neriifolin (CHEBI:7522) has role cardiotonic drug (CHEBI:38147) |
| neriifolin (CHEBI:7522) has role neuroprotective agent (CHEBI:63726) |
| neriifolin (CHEBI:7522) has role toxin (CHEBI:27026) |
| neriifolin (CHEBI:7522) is a cardenolide glycoside (CHEBI:38092) |
| Incoming Relation(s) |
| cerberin (CHEBI:75049) has functional parent neriifolin (CHEBI:7522) |
| IUPAC Name |
|---|
| 3β-(6-deoxy-3-O-methyl-α-L-glucopyranosyloxy)-14-hydroxy-5β-card-20(22)-enolide |
| Synonyms | Source |
|---|---|
| Neriifolin | KEGG COMPOUND |
| Digitoxigenin 3-(alpha-L-thevetoside) | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08876 | KEGG COMPOUND |
| LMST01120021 | LIPID MAPS |
| C00003632 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:100752 | Beilstein |
| CAS:466-07-9 | KEGG COMPOUND |
| CAS:466-07-9 | ChemIDplus |
| Citations |
|---|