EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O8 |
| Net Charge | 0 |
| Average Mass | 534.690 |
| Monoisotopic Mass | 534.31927 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)CC[C@]4([H])C3=CC(=O)OC3)[C@@]1(C)CC[C@H](O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](OC)[C@@H]1O)C2 |
| InChI | InChI=1S/C30H46O8/c1-16-24(32)26(35-4)25(33)27(37-16)38-19-7-10-28(2)18(14-19)5-6-22-21(28)8-11-29(3)20(9-12-30(22,29)34)17-13-23(31)36-15-17/h13,16,18-22,24-27,32-34H,5-12,14-15H2,1-4H3/t16-,18+,19-,20+,21-,22+,24-,25-,26+,27-,28-,29+,30-/m0/s1 |
| InChIKey | VPUNMTHWNSJUOG-BAOINKAISA-N |
| Roles Classification |
|---|
| Biological Role: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neriifolin (CHEBI:7522) has functional parent digitoxigenin (CHEBI:42219) |
| neriifolin (CHEBI:7522) has role cardiotonic drug (CHEBI:38147) |
| neriifolin (CHEBI:7522) has role neuroprotective agent (CHEBI:63726) |
| neriifolin (CHEBI:7522) has role toxin (CHEBI:27026) |
| neriifolin (CHEBI:7522) is a cardenolide glycoside (CHEBI:38092) |
| Incoming Relation(s) |
| cerberin (CHEBI:75049) has functional parent neriifolin (CHEBI:7522) |
| IUPAC Name |
|---|
| 3β-(6-deoxy-3-O-methyl-α-L-glucopyranosyloxy)-14-hydroxy-5β-card-20(22)-enolide |
| Synonyms | Source |
|---|---|
| Digitoxigenin 3-(alpha-L-thevetoside) | KEGG COMPOUND |
| Neriifolin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003632 | KNApSAcK |
| C08876 | KEGG COMPOUND |
| LMST01120021 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:100752 | Beilstein |
| CAS:466-07-9 | KEGG COMPOUND |
| CAS:466-07-9 | ChemIDplus |
| Citations |
|---|