EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:752146 - dextroamphetamine phosphate
| Formula | C9H13N.H3O4P |
| Net Charge | 0 |
| Average Mass | 233.204 |
| Monoisotopic Mass | 233.08169 |
| SMILES | C[C@H](N)Cc1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C9H13N.H3O4P/c1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2-6,8H,7,10H2,1H3;(H3,1,2,3,4)/t8-;/m0./s1 |
| InChIKey | ZHVLGOLHHYJSBZ-QRPNPIFTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextroamphetamine phosphate (CHEBI:752146) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| Amfe-dyn | ChEMBL |
| Bar-dex | ChEMBL |
| Depalone | ChEMBL |
| Dexamfetamine phosphate | ChEMBL |
| Dextroamphetamine phosphate | ChEMBL |