EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2S2 |
| Net Charge | 0 |
| Average Mass | 162.283 |
| Monoisotopic Mass | 162.02854 |
| SMILES | CN1CSC(=S)N(C)C1 |
| InChI | InChI=1S/C5H10N2S2/c1-6-3-7(2)5(8)9-4-6/h3-4H2,1-2H3 |
| InChIKey | QAYICIQNSGETAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | herbicide A substance used to destroy plant pests. nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dazomet (CHEBI:75212) has role antibacterial agent (CHEBI:33282) |
| dazomet (CHEBI:75212) has role antifungal agrochemical (CHEBI:86328) |
| dazomet (CHEBI:75212) has role herbicide (CHEBI:24527) |
| dazomet (CHEBI:75212) has role nematicide (CHEBI:25491) |
| dazomet (CHEBI:75212) is a dithiocarbamic ester (CHEBI:38129) |
| dazomet (CHEBI:75212) is a thiadiazinane (CHEBI:38781) |
| IUPAC Name |
|---|
| 3,5-dimethyl-1,3,5-thiadiazinane-2-thione |
| Synonyms | Source |
|---|---|
| 2-thio-3,5-dimethyltetrahydro-1,3,5-thiadiazine | ChemIDplus |
| 3,5-dimethyl-1,3,5-(2H)-tetrahydrothiadiazine-2-thione | ChemIDplus |
| 3,5-dimethyl-2-thionotetrahydro-1,3,5-thiadiazine | ChemIDplus |
| 3,5-dimethyltetrahydro-1,3,5-2H-thiadiazine-2-thione | ChemIDplus |
| 3,5-dimethyltetrahydro-1,3,5-thiadiazine-2-thione | ChemIDplus |
| 3,5-dimethyltetrahydro-2H-1,3,5-thiadiazine-2-thione | ChemIDplus |
| Brand Names | Source |
|---|---|
| Basamid | NIST Chemistry WebBook |
| Crag 974 | ChemIDplus |
| Dazoberg | ChEBI |
| Mylone | ChemIDplus |
| Citations |
|---|