EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NS2 |
| Net Charge | 0 |
| Average Mass | 149.284 |
| Monoisotopic Mass | 149.03329 |
| SMILES | CN(C)C1CSSC1 |
| InChI | InChI=1S/C5H11NS2/c1-6(2)5-3-7-8-4-5/h5H,3-4H2,1-2H3 |
| InChIKey | DSOOGBGKEWZRIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nereistoxin (CHEBI:7521) has role insecticide (CHEBI:24852) |
| nereistoxin (CHEBI:7521) has role toxin (CHEBI:27026) |
| nereistoxin (CHEBI:7521) is a dithiolanes (CHEBI:39192) |
| IUPAC Name |
|---|
| N,N-dimethyl-1,2-dithiolan-4-amine |
| Synonyms | Source |
|---|---|
| Nereistoxin | KEGG COMPOUND |
| [1,2]dithiolan-4-yl-dimethyl-amine | ChEBI |
| 4-(N,N-dimethylamino)-1,2-dithiolane | ChEBI |
| 4-Dimethylamino-1,2-dithiolan | ChEBI |
| Citations |
|---|