EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N3O |
| Net Charge | 0 |
| Average Mass | 189.218 |
| Monoisotopic Mass | 189.09021 |
| SMILES | C/C=C/C=N\NC(=O)c1ccncc1 |
| InChI | InChI=1S/C10H11N3O/c1-2-3-6-12-13-10(14)9-4-7-11-8-5-9/h2-8H,1H3,(H,13,14)/b3-2+,12-6- |
| InChIKey | YLWYNCPRXFCNLQ-OBBGFGQDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crotoniazide (CHEBI:752096) is a aromatic carboxylic acid (CHEBI:33859) |
| crotoniazide (CHEBI:752096) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| INNs | Source |
|---|---|
| crotoniazida | WHO MedNet |
| crotoniazide | WHO MedNet |