EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11Br3N2O5 |
| Net Charge | 0 |
| Average Mass | 502.941 |
| Monoisotopic Mass | 499.82181 |
| SMILES | CC(=O)Nc1c(Br)c(C(=O)O)c(Br)c(C(=O)NCCO)c1Br |
| InChI | InChI=1S/C12H11Br3N2O5/c1-4(19)17-10-8(14)5(11(20)16-2-3-18)7(13)6(9(10)15)12(21)22/h18H,2-3H2,1H3,(H,16,20)(H,17,19)(H,21,22) |
| InChIKey | HGWOCGUIQUERSN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| broxitalamic acid (CHEBI:752087) is a amidobenzoic acid (CHEBI:48470) |
| INNs | Source |
|---|---|
| acide broxitalamique | WHO MedNet |
| acido broxitalamico | WHO MedNet |
| broxitalamic acid | WHO MedNet |