EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HBr.C24H40N2 |
| Net Charge | 0 |
| Average Mass | 437.510 |
| Monoisotopic Mass | 436.24531 |
| SMILES | Br.[H][C@@]12CC=C3C[C@@H](N(C)C)CC[C@]3(C)[C@@]1([H])CC[C@]13CN(C)[C@@H](C)[C@@]1([H])CC[C@@]23[H] |
| InChI | InChI=1S/C24H40N2.BrH/c1-16-20-8-9-22-19-7-6-17-14-18(25(3)4)10-12-23(17,2)21(19)11-13-24(20,22)15-26(16)5;/h6,16,18-22H,7-15H2,1-5H3;1H/t16-,18-,19+,20+,21-,22-,23-,24-;/m0./s1 |
| InChIKey | OTCCVPFCVOYYIX-NGCSWESXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| conessine hydrobromide (CHEBI:752073) is a steroid alkaloid (CHEBI:26767) |
| Synonyms | Source |
|---|---|
| Conessine dihydrobromide | ChEMBL |
| Conessine hbr | ChEMBL |
| Conessine hydrobromide | ChEMBL |