EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N4O5 |
| Net Charge | 0 |
| Average Mass | 326.353 |
| Monoisotopic Mass | 326.15902 |
| SMILES | CC(C)[C@H](N)C(=O)O[C@@H]1C[C@@H](n2ccc(N)nc2=O)O[C@H]1CO |
| InChI | InChI=1S/C14H22N4O5/c1-7(2)12(16)13(20)23-8-5-11(22-9(8)6-19)18-4-3-10(15)17-14(18)21/h3-4,7-9,11-12,19H,5-6,16H2,1-2H3,(H2,15,17,21)/t8-,9+,11+,12+/m1/s1 |
| InChIKey | VFCYZPOEGWLYRM-QCZKYFFMSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valtorcitabine (CHEBI:752042) has role anti-HBV agent (CHEBI:64951) |
| valtorcitabine (CHEBI:752042) is a pyrimidine nucleoside (CHEBI:26440) |
| INNs | Source |
|---|---|
| valtorcitabina | WHO MedNet |
| valtorcitabine | WHO MedNet |
| Synonym | Source |
|---|---|
| 3'-val-l-dc | ChEMBL |