EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C19H17N5O7S3 |
| Net Charge | 0 |
| Average Mass | 560.035 |
| Monoisotopic Mass | 559.00569 |
| SMILES | Cl.[H][C@]12SCC(CSC(=O)c3ccco3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C19H17N5O7S3.ClH/c1-30-23-11(9-7-34-19(20)21-9)14(25)22-12-15(26)24-13(17(27)28)8(5-32-16(12)24)6-33-18(29)10-3-2-4-31-10;/h2-4,7,12,16H,5-6H2,1H3,(H2,20,21)(H,22,25)(H,27,28);1H/b23-11-;/t12-,16-;/m1./s1 |
| InChIKey | KEQFDTJEEQKVLM-JUODUXDSSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftiofur hydrochloride (CHEBI:752031) is a cephalosporin (CHEBI:23066) |
| Synonyms | Source |
|---|---|
| Ceftiofur hcl | ChEMBL |
| Ceftiofur hydrochloride | ChEMBL |
| Ceftiofur monohydrochloride | ChEMBL |
| NSC-759845 | ChEMBL |
| U-64279A | ChEMBL |