EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32FNO13 |
| Net Charge | 0 |
| Average Mass | 633.578 |
| Monoisotopic Mass | 633.18577 |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)COC(=O)CCN)C[C@@H]3O[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C30H32FNO13/c1-11-23(35)28(40)22(31)29(44-11)45-15-9-30(41,16(33)10-43-17(34)6-7-32)8-13-19(15)27(39)21-20(25(13)37)24(36)12-4-3-5-14(42-2)18(12)26(21)38/h3-5,11,15,22-23,28-29,35,37,39-41H,6-10,32H2,1-2H3/t11-,15-,22+,23+,28-,29-,30-/m0/s1 |
| InChIKey | CKXIPXAIFMTQCS-LRDUUELOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galarubicin (CHEBI:752011) is a anthracycline (CHEBI:48120) |
| INNs | Source |
|---|---|
| galarubicin | WHO MedNet |
| galarubicina | WHO MedNet |
| galarubicine | WHO MedNet |