EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3S |
| Net Charge | 0 |
| Average Mass | 163.198 |
| Monoisotopic Mass | 163.03031 |
| SMILES | C[C@@H](S)C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)/t3-/m1/s1 |
| InChIKey | YTGJWQPHMWSCST-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextiopronin (CHEBI:752007) is a N-acylglycine (CHEBI:16180) |
| INNs | Source |
|---|---|
| dextiopronin | WHO MedNet |
| dextiopronina | WHO MedNet |
| dextiopronine | WHO MedNet |
| Synonym | Source |
|---|---|
| Tiopronin, (r)- | ChEMBL |