EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H21Br3I3N5O8 |
| Net Charge | 0 |
| Average Mass | 1127.883 |
| Monoisotopic Mass | 1124.60744 |
| SMILES | CNC(=O)c1c(Br)c(C(=O)NCC(=O)Nc2c(I)c(C(=O)O)c(I)c(C(=O)NCCO)c2I)c(Br)c(N(C)C(C)=O)c1Br |
| InChI | InChI=1S/C24H21Br3I3N5O8/c1-7(37)35(3)20-14(26)9(21(39)31-2)13(25)10(15(20)27)22(40)33-6-8(38)34-19-17(29)11(23(41)32-4-5-36)16(28)12(18(19)30)24(42)43/h36H,4-6H2,1-3H3,(H,31,39)(H,32,41)(H,33,40)(H,34,38)(H,42,43) |
| InChIKey | OJCPHFBLBNKCNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ioxabrolic acid (CHEBI:751982) is a amidobenzoic acid (CHEBI:48470) |
| INNs | Source |
|---|---|
| acide ioxabrolique | WHO MedNet |
| acido ioxabrolico | WHO MedNet |
| ioxabrolic acid | WHO MedNet |