EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C8H3I2NO5.Na |
| Net Charge | 0 |
| Average Mass | 492.902 |
| Monoisotopic Mass | 492.78961 |
| SMILES | Cn1c(C(=O)[O-])c(I)c(=O)c(I)c1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H5I2NO5.2Na/c1-11-4(7(13)14)2(9)6(12)3(10)5(11)8(15)16;;/h1H3,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | GMQNYSMZUWAAIN-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodomethamate sodium (CHEBI:751972) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| Idomethamate sodium | ChEMBL |
| Iodomethamate sodium | ChEMBL |
| Iodoxyl | ChEMBL |
| Sodium iodomethamate | ChEMBL |