EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N.C4H6O4 |
| Net Charge | 0 |
| Average Mass | 253.298 |
| Monoisotopic Mass | 253.13141 |
| SMILES | C[C@@H](N)Cc1ccccc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C9H13N.C4H6O4/c1-8(10)7-9-5-3-2-4-6-9;5-3(6)1-2-4(7)8/h2-6,8H,7,10H2,1H3;1-2H2,(H,5,6)(H,7,8)/t8-;/m1./s1 |
| InChIKey | HVANWDSTOFDWRV-DDWIOCJRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levamfetamine succinate (CHEBI:751971) is a amphetamines (CHEBI:35338) |
| Synonym | Source |
|---|---|
| Levamphetamine succinate | ChEMBL |