EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9I3N2O5 |
| Net Charge | 0 |
| Average Mass | 629.914 |
| Monoisotopic Mass | 629.76457 |
| SMILES | CC(=O)Nc1c(I)c(NC(=O)CO)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C11H9I3N2O5/c1-3(18)15-9-6(12)5(11(20)21)7(13)10(8(9)14)16-4(19)2-17/h17H,2H2,1H3,(H,15,18)(H,16,19)(H,20,21) |
| InChIKey | KISFRFNQZTVXGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ioxotrizoic acid (CHEBI:751970) is a amidobenzoic acid (CHEBI:48470) |
| INNs | Source |
|---|---|
| acide ioxotrizoique | WHO MedNet |
| acido ioxotrizoico | WHO MedNet |
| ioxotrizoic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| SH 2.1139/H 248 AB | ChEMBL |
| SH-2.1139/H 248 AB | ChEMBL |