EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:751959 - dimethylaminoethyl reserpilinate
| Formula | C26H35N3O5 |
| Net Charge | 0 |
| Average Mass | 469.582 |
| Monoisotopic Mass | 469.25767 |
| SMILES | [H][C@@]12CN3CCc4c(nc5cc(OC)ccc45)[C@@]3([H])C[C@]1([H])C(C(=O)OCCN(C)C)=C(OC)O[C@H]2C |
| InChI | InChI=1S/C26H35N3O5/c1-15-20-14-29-9-8-18-17-7-6-16(31-4)12-21(17)27-24(18)22(29)13-19(20)23(26(32-5)34-15)25(30)33-11-10-28(2)3/h6-7,12,15,19-20,22,27H,8-11,13-14H2,1-5H3/t15-,19-,20-,22+/m0/s1 |
| InChIKey | HTVYZQDNQXGFOF-WWMNNVMHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethylaminoethyl reserpilinate (CHEBI:751959) is a yohimban alkaloid (CHEBI:27358) |
| Synonyms | Source |
|---|---|
| Antipressine | ChEMBL |
| Deanol reserpilinate | ChEMBL |
| Reserpilinate dimethylaminoethyl | ChEMBL |