EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:751951 - idaverine
| Formula | C24H39N3O3 |
| Net Charge | 0 |
| Average Mass | 417.594 |
| Monoisotopic Mass | 417.29914 |
| SMILES | CCN(CCCC(=O)N1CCC(C(=O)N(C)C)CC1)[C@@H](C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H39N3O3/c1-6-26(19(2)18-20-9-11-22(30-5)12-10-20)15-7-8-23(28)27-16-13-21(14-17-27)24(29)25(3)4/h9-12,19,21H,6-8,13-18H2,1-5H3/t19-/m0/s1 |
| InChIKey | FUWZBLSXACKFQX-IBGZPJMESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| idaverine (CHEBI:751951) is a amphetamines (CHEBI:35338) |
| INNs | Source |
|---|---|
| idaverina | WHO MedNet |
| idaverine | WHO MedNet |