EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C17H23NO |
| Net Charge | 0 |
| Average Mass | 293.838 |
| Monoisotopic Mass | 293.15464 |
| SMILES | Cl.[H][C@]12CCCC[C@]13CCN(C)[C@H]2Cc1ccc(O)cc13 |
| InChI | InChI=1S/C17H23NO.ClH/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17;/h5-6,11,14,16,19H,2-4,7-10H2,1H3;1H/t14-,16+,17+;/m1./s1 |
| InChIKey | MKMAMQPDRUXVSS-YPYJQMNVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextrorphan hydrochloride (CHEBI:751923) is a morphinane alkaloid (CHEBI:25418) |
| Synonyms | Source |
|---|---|
| Dextrorphan hydrochloride | ChEMBL |
| RO 01-67941706 | ChEMBL |
| RO 01-6794/706 | ChEMBL |
| RO-01-6794/706 | ChEMBL |
| Ro-16794 | ChEMBL |
| RO-1-6794/706 | ChEMBL |