EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75192 - thallium(I) acetate
| Formula | C2H3O2.Tl |
| Net Charge | 0 |
| Average Mass | 263.427 |
| Monoisotopic Mass | 263.98773 |
| SMILES | CC(=O)[O-].[Tl+] |
| InChI | InChI=1S/C2H4O2.Tl/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| InChIKey | HQOJMTATBXYHNR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thallium(I) acetate (CHEBI:75192) has part thallium(1+) (CHEBI:49920) |
| thallium(I) acetate (CHEBI:75192) has role apoptosis inducer (CHEBI:68495) |
| thallium(I) acetate (CHEBI:75192) has role neurotoxin (CHEBI:50910) |
| thallium(I) acetate (CHEBI:75192) is a acetate salt (CHEBI:59230) |
| thallium(I) acetate (CHEBI:75192) is a thallium molecular entity (CHEBI:37110) |
| IUPAC Name |
|---|
| thallium(1+) acetate |
| Synonyms | Source |
|---|---|
| Acetic acid, thallium(I) salt | ChemIDplus |
| Thallium monoacetate | ChemIDplus |
| Thallous acetate | ChemIDplus |
| Acetic acid, thallium(1+) salt | ChemIDplus |
| Thallium acetate | ChemIDplus |
| Citations |
|---|