EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO3 |
| Net Charge | 0 |
| Average Mass | 281.311 |
| Monoisotopic Mass | 281.10519 |
| SMILES | C[C@H](C(=O)O)c1ccc(N2Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H15NO3/c1-11(17(20)21)12-6-8-14(9-7-12)18-10-13-4-2-3-5-15(13)16(18)19/h2-9,11H,10H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | RJMIEHBSYVWVIN-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexindoprofen (CHEBI:751901) is a benzenes (CHEBI:22712) |
| dexindoprofen (CHEBI:751901) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| dexindoprofen | WHO MedNet |
| dexindoprofene | WHO MedNet |
| dexindoprofeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| D-indoprofen | ChEMBL |
| Indoprofen (+)-form | ChEMBL |
| Nedius | ChEMBL |