EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | [H][C@@]12C(=O)OC=C(C)[C@@]1([H])CC[C@@H]2C |
| InChI | InChI=1S/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3/t6-,8+,9-/m0/s1 |
| InChIKey | ZDKZHVNKFOXMND-ZQARSLAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nepeta racemosa (ncbitaxon:54731) | - | PubMed (15974613) | |
| Nepeta rtanjensis (IPNI:452698-1) | - | DOI ( 10.1016/j.indcrop.2017.02.027 ) | |
| Nepeta cataria (ncbitaxon:39347) | - | PubMed (21056438) | |
| Nepeta parnassica (IPNI:452640-1) | aerial part (BTO:0001658) | PubMed (24449446) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | insect repellent An insecticide that acts as a repellent to insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-cis-nepetalactone (CHEBI:7519) has role antibacterial agent (CHEBI:33282) |
| trans-cis-nepetalactone (CHEBI:7519) has role antifungal agent (CHEBI:35718) |
| trans-cis-nepetalactone (CHEBI:7519) has role insect repellent (CHEBI:71692) |
| trans-cis-nepetalactone (CHEBI:7519) has role plant metabolite (CHEBI:76924) |
| trans-cis-nepetalactone (CHEBI:7519) is a cyclopentapyran (CHEBI:38606) |
| trans-cis-nepetalactone (CHEBI:7519) is a iridoid monoterpenoid (CHEBI:50563) |
| IUPAC Name |
|---|
| (4aS,7S,7aS)-4,7-dimethyl-5,6,7,7a-tetrahydrocyclopenta[c]pyran-1(4aH)-one |
| Synonyms | Source |
|---|---|
| nepetalactone trans-cis-form | KEGG COMPOUND |
| (+)-(4aS,7S,7aS)-nepetalactone | ChemIDplus |
| (+)-trans,cis-nepetalactone | ChemIDplus |
| trans,cis-nepetalactone | ChemIDplus |
| (4aS,7S,7aS)-nepetalactone | ChemIDplus |
| E,Z-nepetalactone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09792 | KEGG COMPOUND |
| C00003092 | KNApSAcK |
| LMPR0102070014 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:17257-15-7 | KEGG COMPOUND |
| CAS:17257-15-7 | ChemIDplus |
| Citations |
|---|