EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | [H][C@@]12C(=O)OC=C(C)[C@@]1([H])CC[C@@H]2C |
| InChI | InChI=1S/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3/t6-,8+,9-/m0/s1 |
| InChIKey | ZDKZHVNKFOXMND-ZQARSLAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nepeta cataria (ncbitaxon:39347) | - | PubMed (21056438) | |
| Nepeta parnassica (IPNI:452640-1) | aerial part (BTO:0001658) | PubMed (24449446) | |
| Nepeta racemosa (ncbitaxon:54731) | - | PubMed (15974613) | |
| Nepeta rtanjensis (IPNI:452698-1) | - | DOI ( 10.1016/j.indcrop.2017.02.027 ) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | insect repellent An insecticide that acts as a repellent to insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-cis-nepetalactone (CHEBI:7519) has role antibacterial agent (CHEBI:33282) |
| trans-cis-nepetalactone (CHEBI:7519) has role antifungal agent (CHEBI:35718) |
| trans-cis-nepetalactone (CHEBI:7519) has role insect repellent (CHEBI:71692) |
| trans-cis-nepetalactone (CHEBI:7519) has role plant metabolite (CHEBI:76924) |
| trans-cis-nepetalactone (CHEBI:7519) is a cyclopentapyran (CHEBI:38606) |
| trans-cis-nepetalactone (CHEBI:7519) is a iridoid monoterpenoid (CHEBI:50563) |
| IUPAC Name |
|---|
| (4aS,7S,7aS)-4,7-dimethyl-5,6,7,7a-tetrahydrocyclopenta[c]pyran-1(4aH)-one |
| Synonyms | Source |
|---|---|
| (+)-(4aS,7S,7aS)-nepetalactone | ChemIDplus |
| (4aS,7S,7aS)-nepetalactone | ChemIDplus |
| (4aα,7α,7aβ)-5,6,7,7a-tetrahydro-4,7-dimethylcyclopenta[c]pyran-1(4aH)-one | ChEBI |
| 4aα,7α,7aβ-nepetalactone | ChEBI |
| epinepetalactone | ChemIDplus |
| E,Z-nepetalactone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00003092 | KNApSAcK |
| C09792 | KEGG COMPOUND |
| LMPR0102070014 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:17257-15-7 | KEGG COMPOUND |
| CAS:17257-15-7 | ChemIDplus |
| Citations |
|---|