EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:751899 - fantridone hydrochloride
| Formula | HCl.C18H20N2O |
| Net Charge | 0 |
| Average Mass | 316.832 |
| Monoisotopic Mass | 316.13424 |
| SMILES | CN(C)CCCn1c(=O)c2ccccc2c2ccccc21.Cl |
| InChI | InChI=1S/C18H20N2O.ClH/c1-19(2)12-7-13-20-17-11-6-5-9-15(17)14-8-3-4-10-16(14)18(20)21;/h3-6,8-11H,7,12-13H2,1-2H3;1H |
| InChIKey | VRCYZPYOTBBJKU-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fantridone hydrochloride (CHEBI:751899) is a phenanthridines (CHEBI:51245) |
| Synonyms | Source |
|---|---|
| AGN 616 | ChEMBL |
| AGN-616 | ChEMBL |
| Fanthridone | ChEMBL |
| Fantridone hcl | ChEMBL |
| Fantridone hydrochloride | ChEMBL |
| Fantridone hydrochloride hydrate | ChEMBL |