EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Ca.C6H5O5S.C6H5O5S |
| Net Charge | 0 |
| Average Mass | 418.414 |
| Monoisotopic Mass | 417.93413 |
| SMILES | O=S(=O)([O-])c1cc(O)ccc1O.O=S(=O)([O-])c1cc(O)ccc1O.[Ca+2] |
| InChI | InChI=1S/2C6H6O5S.Ca/c2*7-4-1-2-5(8)6(3-4)12(9,10)11;/h2*1-3,7-8H,(H,9,10,11);/q;;+2/p-2 |
| InChIKey | QGNBTYAQAPLTMX-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcium dobesilate (CHEBI:751864) has role antiviral agent (CHEBI:22587) |
| calcium dobesilate (CHEBI:751864) has role hypoglycemic agent (CHEBI:35526) |
| calcium dobesilate (CHEBI:751864) is a organosulfur compound (CHEBI:33261) |
| calcium dobesilate (CHEBI:751864) is a sulfonic acid derivative (CHEBI:33552) |
| INNs | Source |
|---|---|
| dobesilate de calcium | WHO MedNet |
| dobesilato de calcio | WHO MedNet |
| Synonyms | Source |
|---|---|
| 205 E | ChEMBL |
| 205-E | ChEMBL |
| Calcium dobesilate | ChEMBL |
| Dexium | ChEMBL |
| Dobesilate calcium | ChEMBL |
| Hydroquinone calcium sulfonate | ChEMBL |
| Brand Names | Source |
|---|---|
| Doxium | ChEMBL |
| Doxium 500 | ChEMBL |
| Citations |
|---|