EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13Cl2FN2O2S2 |
| Net Charge | 0 |
| Average Mass | 347.264 |
| Monoisotopic Mass | 345.97795 |
| SMILES | Cc1ccc(N(SC(F)(Cl)Cl)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C10H13Cl2FN2O2S2/c1-8-4-6-9(7-5-8)15(18-10(11,12)13)19(16,17)14(2)3/h4-7H,1-3H3 |
| InChIKey | HYVWIQDYBVKITD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolylfluanid (CHEBI:75182) has functional parent sulfamide (CHEBI:29368) |
| tolylfluanid (CHEBI:75182) has role antifungal agrochemical (CHEBI:86328) |
| tolylfluanid (CHEBI:75182) has role genotoxin (CHEBI:50902) |
| tolylfluanid (CHEBI:75182) is a organochlorine compound (CHEBI:36683) |
| tolylfluanid (CHEBI:75182) is a organofluorine compound (CHEBI:37143) |
| tolylfluanid (CHEBI:75182) is a phenylsulfamide fungicide (CHEBI:87026) |
| tolylfluanid (CHEBI:75182) is a sulfamides (CHEBI:51871) |
| IUPAC Name |
|---|
| N-{[dichloro(fluoro)methyl]sulfanyl}-N',N'-dimethyl-N-(4-methylphenyl)sulfuric diamide |
| Synonyms | Source |
|---|---|
| Tolylfluanide | ChemIDplus |
| 1,1-Dichloro-N-((dimethylamino)sulfonyl)-1-fluoro-N-(4-methylphenyl)methanesulfenamide | ChemIDplus |
| Dichloro-N-((dimethylamino)sulphonyl)fluoro-N-(p-tolyl)methanesulphenamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Euparen Multi | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18899 | KEGG COMPOUND |
| EP1527683 | Patent |
| US2011195946 | Patent |
| tolylfluanid | Alan Wood's Pesticides |
| 645 | PPDB |
| Citations |
|---|