EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | [H][C@]12CC[C@H](C)[C@@]1([H])C(=O)OC=C2C |
| InChI | InChI=1S/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3/t6-,8+,9+/m0/s1 |
| InChIKey | ZDKZHVNKFOXMND-NBEYISGCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cinara pilicornis (ncbitaxon:506607) | - | PubMed (18166192) | |
| Nepeta caesarea (IPNI:452314-1) | - | PubMed (9720633) | |
| Nepeta cataria (ncbitaxon:39347) | leaf (BTO:0000713) | PubMed (29091815) | |
| Nepeta racemosa (ncbitaxon:54731) | - | PubMed (15974613) | |
| Nepeta sibirica (ncbitaxon:180189) | - | PubMed (20307630) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. insect attractant A chemical that attracts insects. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | insect repellent An insecticide that acts as a repellent to insects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-trans-nepetalactone (CHEBI:7518) has role analgesic (CHEBI:35480) |
| cis-trans-nepetalactone (CHEBI:7518) has role antibacterial agent (CHEBI:33282) |
| cis-trans-nepetalactone (CHEBI:7518) has role antifungal agent (CHEBI:35718) |
| cis-trans-nepetalactone (CHEBI:7518) has role insect attractant (CHEBI:24850) |
| cis-trans-nepetalactone (CHEBI:7518) has role insect repellent (CHEBI:71692) |
| cis-trans-nepetalactone (CHEBI:7518) has role pheromone (CHEBI:26013) |
| cis-trans-nepetalactone (CHEBI:7518) has role plant metabolite (CHEBI:76924) |
| cis-trans-nepetalactone (CHEBI:7518) is a cyclopentapyran (CHEBI:38606) |
| cis-trans-nepetalactone (CHEBI:7518) is a iridoid monoterpenoid (CHEBI:50563) |
| IUPAC Name |
|---|
| (4aS,7S,7aR)-4,7-dimethyl-5,6,7,7a-tetrahydrocyclopenta[c]pyran-1(4aH)-one |
| Synonyms | Source |
|---|---|
| (4aS)-5,6,7,7aα-tetrahydro-4,7α-dimethylcyclopenta[c]pyran-1(4aH)-one | ChEBI |
| (+)-(4aS,7S,7aR)-nepetalactone | ChEBI |
| (4aS,7S,7aR)-nepetalactone | ChemIDplus |
| 4aα,7α,7aα-nepetalactone | ChemIDplus |
| (+)-cis,trans-nepetalactone | MetaCyc |
| cis,trans-nepetalactone | ChEBI |
| UniProt Name | Source |
|---|---|
| cis-trans-nepetalactone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003091 | KNApSAcK |
| C09791 | KEGG COMPOUND |
| CPD-15029 | MetaCyc |
| LMPR0102070013 | LIPID MAPS |
| Nepetalactone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:21651-62-7 | NIST Chemistry WebBook |
| CAS:21651-62-7 | KEGG COMPOUND |
| CAS:21651-62-7 | ChemIDplus |
| Citations |
|---|