EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | [H][C@]12CC[C@H](C)[C@@]1([H])C(=O)OC=C2C |
| InChI | InChI=1S/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3/t6-,8+,9+/m0/s1 |
| InChIKey | ZDKZHVNKFOXMND-NBEYISGCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cinara pilicornis (ncbitaxon:506607) | - | PubMed (18166192) | |
| Nepeta caesarea (IPNI:452314-1) | - | PubMed (9720633) | |
| Nepeta cataria (ncbitaxon:39347) | leaf (BTO:0000713) | PubMed (29091815) | |
| Nepeta racemosa (ncbitaxon:54731) | - | PubMed (15974613) | |
| Nepeta sibirica (ncbitaxon:180189) | - | PubMed (20307630) |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. insect attractant A chemical that attracts insects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | insect repellent An insecticide that acts as a repellent to insects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-trans-nepetalactone (CHEBI:7518) has role analgesic (CHEBI:35480) |
| cis-trans-nepetalactone (CHEBI:7518) has role antibacterial agent (CHEBI:33282) |
| cis-trans-nepetalactone (CHEBI:7518) has role antifungal agent (CHEBI:35718) |
| cis-trans-nepetalactone (CHEBI:7518) has role insect attractant (CHEBI:24850) |
| cis-trans-nepetalactone (CHEBI:7518) has role insect repellent (CHEBI:71692) |
| cis-trans-nepetalactone (CHEBI:7518) has role pheromone (CHEBI:26013) |
| cis-trans-nepetalactone (CHEBI:7518) has role plant metabolite (CHEBI:76924) |
| cis-trans-nepetalactone (CHEBI:7518) is a cyclopentapyran (CHEBI:38606) |
| cis-trans-nepetalactone (CHEBI:7518) is a iridoid monoterpenoid (CHEBI:50563) |
| IUPAC Name |
|---|
| (4aS,7S,7aR)-4,7-dimethyl-5,6,7,7a-tetrahydrocyclopenta[c]pyran-1(4aH)-one |
| Synonyms | Source |
|---|---|
| (4aS)-5,6,7,7aα-tetrahydro-4,7α-dimethylcyclopenta[c]pyran-1(4aH)-one | ChEBI |
| (+)-(4aS,7S,7aR)-nepetalactone | ChEBI |
| (4aS,7S,7aR)-nepetalactone | ChemIDplus |
| 4aα,7α,7aα-nepetalactone | ChemIDplus |
| (+)-cis,trans-nepetalactone | MetaCyc |
| cis,trans-nepetalactone | ChEBI |
| UniProt Name | Source |
|---|---|
| cis-trans-nepetalactone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003091 | KNApSAcK |
| C09791 | KEGG COMPOUND |
| CPD-15029 | MetaCyc |
| LMPR0102070013 | LIPID MAPS |
| Nepetalactone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:21651-62-7 | NIST Chemistry WebBook |
| CAS:21651-62-7 | KEGG COMPOUND |
| CAS:21651-62-7 | ChemIDplus |
| Citations |
|---|