EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | [H][C@]12CC[C@H](C)[C@@]1([H])C(=O)OC=C2C |
| InChI | InChI=1S/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3/t6-,8+,9+/m0/s1 |
| InChIKey | ZDKZHVNKFOXMND-NBEYISGCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cinara pilicornis (ncbitaxon:506607) | - | PubMed (18166192) | |
| Nepeta cataria (ncbitaxon:39347) | leaf (BTO:0000713) | PubMed (29091815) | |
| Nepeta racemosa (ncbitaxon:54731) | - | PubMed (15974613) | |
| Nepeta sibirica (ncbitaxon:180189) | - | PubMed (20307630) | |
| Nepeta caesarea (IPNI:452314-1) | - | PubMed (9720633) |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. insect attractant A chemical that attracts insects. |
| Applications: | insect repellent An insecticide that acts as a repellent to insects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-trans-nepetalactone (CHEBI:7518) has role analgesic (CHEBI:35480) |
| cis-trans-nepetalactone (CHEBI:7518) has role antibacterial agent (CHEBI:33282) |
| cis-trans-nepetalactone (CHEBI:7518) has role antifungal agent (CHEBI:35718) |
| cis-trans-nepetalactone (CHEBI:7518) has role insect attractant (CHEBI:24850) |
| cis-trans-nepetalactone (CHEBI:7518) has role insect repellent (CHEBI:71692) |
| cis-trans-nepetalactone (CHEBI:7518) has role pheromone (CHEBI:26013) |
| cis-trans-nepetalactone (CHEBI:7518) has role plant metabolite (CHEBI:76924) |
| cis-trans-nepetalactone (CHEBI:7518) is a cyclopentapyran (CHEBI:38606) |
| cis-trans-nepetalactone (CHEBI:7518) is a iridoid monoterpenoid (CHEBI:50563) |
| IUPAC Name |
|---|
| (4aS,7S,7aR)-4,7-dimethyl-5,6,7,7a-tetrahydrocyclopenta[c]pyran-1(4aH)-one |
| Synonyms | Source |
|---|---|
| nepetalactone cis-trans-form | KEGG COMPOUND |
| cis,trans-nepetalactone | ChEBI |
| 4aα,7α,7aα-nepetalactone | ChemIDplus |
| nepetalactone | ChemIDplus |
| (4aS)-5,6,7,7aα-tetrahydro-4,7α-dimethylcyclopenta[c]pyran-1(4aH)-one | ChEBI |
| (4aS,7S,7aR)-nepetalactone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cis-trans-nepetalactone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C09791 | KEGG COMPOUND |
| C00003091 | KNApSAcK |
| LMPR0102070013 | LIPID MAPS |
| Nepetalactone | Wikipedia |
| CPD-15029 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:21651-62-7 | KEGG COMPOUND |
| CAS:21651-62-7 | ChemIDplus |
| CAS:21651-62-7 | NIST Chemistry WebBook |
| Citations |
|---|