EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:751790 - ciladopa hydrochloride
| Formula | HCl.C21H26N2O4 |
| Net Charge | 0 |
| Average Mass | 406.910 |
| Monoisotopic Mass | 406.16594 |
| SMILES | COc1ccc([C@H](O)CN2CCN(c3cccccc3=O)CC2)cc1OC.Cl |
| InChI | InChI=1S/C21H26N2O4.ClH/c1-26-20-9-8-16(14-21(20)27-2)19(25)15-22-10-12-23(13-11-22)17-6-4-3-5-7-18(17)24;/h3-9,14,19,25H,10-13,15H2,1-2H3;1H/t19-;/m1./s1 |
| InChIKey | UIOUCVPFPQUSAS-FSRHSHDFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciladopa hydrochloride (CHEBI:751790) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| AY-27,110 | ChEMBL |
| AY-27110 | ChEMBL |
| Ciladopa hcl | ChEMBL |
| Ciladopa hydrochloride | ChEMBL |
| Brand Name | Source |
|---|---|
| Tremerase | ChEMBL |