EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C29H38N2O6 |
| Net Charge | 0 |
| Average Mass | 547.092 |
| Monoisotopic Mass | 546.24966 |
| SMILES | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C29H38N2O6.ClH/c1-4-6-14-30(15-7-5-2)26(32)18-31-17-23(21-10-13-24-25(16-21)37-19-36-24)27(29(33)34)28(31)20-8-11-22(35-3)12-9-20;/h8-13,16,23,27-28H,4-7,14-15,17-19H2,1-3H3,(H,33,34);1H/t23-,27-,28+;/m1./s1 |
| InChIKey | IJFUJIFSUKPWCZ-SQMFDTLJSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atrasentan hydrochloride (CHEBI:751785) has role antineoplastic agent (CHEBI:35610) |
| atrasentan hydrochloride (CHEBI:751785) is a pyrrolidines (CHEBI:38260) |
| Synonyms | Source |
|---|---|
| A-127722 | ChEMBL |
| A-147627.1 | ChEMBL |
| ABBOT-147627 | ChEMBL |
| Atrasentan hcl | ChEMBL |
| Atrasentan hydrochloride | ChEMBL |