EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N6O8S2 |
| Net Charge | 0 |
| Average Mass | 568.634 |
| Monoisotopic Mass | 568.14100 |
| SMILES | [H][C@]12SCC=C(C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(NC(=O)[C@H](C)N)n1 |
| InChI | InChI=1S/C22H28N6O8S2/c1-10(23)15(29)26-21-24-11(8-38-21)13(27-34-5)16(30)25-14-17(31)28-12(6-7-37-18(14)28)19(32)35-9-36-20(33)22(2,3)4/h6,8,10,14,18H,7,9,23H2,1-5H3,(H,25,30)(H,24,26,29)/b27-13-/t10-,14+,18+/m0/s1 |
| InChIKey | VOPANQNVVCPHQR-IVVGYLHBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftizoxime alapivoxil (CHEBI:751776) is a cephalosporin (CHEBI:23066) |
| INNs | Source |
|---|---|
| ceftizoxima alapivoxilo | WHO MedNet |
| ceftizoxime alapivoxil | WHO MedNet |