EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10ClN3O3 |
| Net Charge | 0 |
| Average Mass | 219.628 |
| Monoisotopic Mass | 219.04107 |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(O)CCl |
| InChI | InChI=1S/C7H10ClN3O3/c1-5-9-3-7(11(13)14)10(5)4-6(12)2-8/h3,6,12H,2,4H2,1H3 |
| InChIKey | IPWKIXLWTCNBKN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antitrichomonal drug A drug used to treat trichomonas infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antitrichomonal drug A drug used to treat trichomonas infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ornidazole (CHEBI:75176) has role antiamoebic agent (CHEBI:171664) |
| ornidazole (CHEBI:75176) has role antibacterial drug (CHEBI:36047) |
| ornidazole (CHEBI:75176) has role antiinfective agent (CHEBI:35441) |
| ornidazole (CHEBI:75176) has role antiprotozoal drug (CHEBI:35820) |
| ornidazole (CHEBI:75176) has role antitrichomonal drug (CHEBI:50685) |
| ornidazole (CHEBI:75176) has role epitope (CHEBI:53000) |
| ornidazole (CHEBI:75176) is a C-nitro compound (CHEBI:35716) |
| ornidazole (CHEBI:75176) is a imidazoles (CHEBI:24780) |
| ornidazole (CHEBI:75176) is a organochlorine compound (CHEBI:36683) |
| ornidazole (CHEBI:75176) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1-chloro-3-(2-methyl-5-nitro-1N-imidazol-1-yl)propan-2-ol |
| INNs | Source |
|---|---|
| ornidazol | ChemIDplus |
| ornidazole | WHO MedNet |
| ornidazole | ChemIDplus |
| ornidazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-hydroxy-3-chloropropyl)-2-methyl-5-nitroimidazole | ChemIDplus |
| 1-(3-chloro-2-hydroxypropyl)-2-methyl-5-nitroimidazole | ChemIDplus |
| Ro 7-0207 | ChemIDplus |
| α-(Chlormethyl)-2-methyl-5-nitro-imidazol-1-aethanol | ChemIDplus |
| α-(chloromethyl)-2-methyl-5-nitro-1H-imidazole-1-ethanol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:614299 | Reaxys |
| CAS:16773-42-5 | ChemIDplus |
| Citations |
|---|