EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75176 - ornidazole
| Formula | C7H10ClN3O3 |
| Net Charge | 0 |
| Average Mass | 219.628 |
| Monoisotopic Mass | 219.04107 |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(O)CCl |
| InChI | InChI=1S/C7H10ClN3O3/c1-5-9-3-7(11(13)14)10(5)4-6(12)2-8/h3,6,12H,2,4H2,1H3 |
| InChIKey | IPWKIXLWTCNBKN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antitrichomonal drug A drug used to treat trichomonas infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antitrichomonal drug A drug used to treat trichomonas infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ornidazole (CHEBI:75176) has role antiamoebic agent (CHEBI:171664) |
| ornidazole (CHEBI:75176) has role antibacterial agent (CHEBI:33282) |
| ornidazole (CHEBI:75176) has role antibacterial drug (CHEBI:36047) |
| ornidazole (CHEBI:75176) has role antiinfective agent (CHEBI:35441) |
| ornidazole (CHEBI:75176) has role antineoplastic agent (CHEBI:35610) |
| ornidazole (CHEBI:75176) has role antiprotozoal drug (CHEBI:35820) |
| ornidazole (CHEBI:75176) has role antitrichomonal drug (CHEBI:50685) |
| ornidazole (CHEBI:75176) has role epitope (CHEBI:53000) |
| ornidazole (CHEBI:75176) is a C-nitro compound (CHEBI:35716) |
| ornidazole (CHEBI:75176) is a imidazoles (CHEBI:24780) |
| ornidazole (CHEBI:75176) is a organochlorine compound (CHEBI:36683) |
| ornidazole (CHEBI:75176) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1-chloro-3-(2-methyl-5-nitro-1N-imidazol-1-yl)propan-2-ol |
| INNs | Source |
|---|---|
| ornidazol | ChemIDplus |
| ornidazole | WHO MedNet |
| ornidazole | ChemIDplus |
| ornidazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-hydroxy-3-chloropropyl)-2-methyl-5-nitroimidazole | ChemIDplus |
| 1-(3-chloro-2-hydroxypropyl)-2-methyl-5-nitroimidazole | ChemIDplus |
| NSC-95075 | ChEMBL |
| Ro 7-0207 | ChemIDplus |
| RO-7-0207 | ChEMBL |
| RO-70207 | ChEMBL |
| Brand Name | Source |
|---|---|
| Tiberal | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:614299 | Reaxys |
| CAS:16773-42-5 | ChemIDplus |
| Citations |
|---|