EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O4S.C22H23ClN2O8 |
| Net Charge | 0 |
| Average Mass | 576.964 |
| Monoisotopic Mass | 576.08167 |
| SMILES | O=S(=O)(O)O.[H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@@]2(C)O |
| InChI | InChI=1S/C22H23ClN2O8.H2O4S/c1-21(32)7-6-8-15(25(2)3)17(28)13(20(24)31)19(30)22(8,33)18(29)11(7)16(27)12-10(26)5-4-9(23)14(12)21;1-5(2,3)4/h4-5,7-8,15,26,28-29,32-33H,6H2,1-3H3,(H2,24,31);(H2,1,2,3,4)/t7-,8-,15-,21-,22-;/m0./s1 |
| InChIKey | GQUMQTDURIYYIA-MRFRVZCGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlortetracycline bisulfate (CHEBI:751745) is a tetracyclines (CHEBI:26895) |
| Synonyms | Source |
|---|---|
| Chlortetracycline bisulfate | ChEMBL |
| Chlortetracycline bisulphate | ChEMBL |