EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.C14H20N2 |
| Net Charge | 0 |
| Average Mass | 332.400 |
| Monoisotopic Mass | 332.17361 |
| SMILES | CC(C)(C)CCC#C[C@@H]1C[C@H]1c1cncn1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H20N2.C4H4O4/c1-14(2,3)7-5-4-6-11-8-12(11)13-9-15-10-16-13;5-3(6)1-2-4(7)8/h9-12H,5,7-8H2,1-3H3,(H,15,16);1-2H,(H,5,6)(H,7,8)/b;2-1-/t11-,12-;/m1./s1 |
| InChIKey | QIQWRCNAPQJQLL-COALEZEGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cipralisant maleate (CHEBI:751743) is a dicarboxylic acid (CHEBI:35692) |
| Synonyms | Source |
|---|---|
| Cipralisant maleate | ChEMBL |
| Gt2331 | ChEMBL |
| GT-2331 | ChEMBL |
| GT-2331 MALEATE | ChEMBL |
| Brand Name | Source |
|---|---|
| Perceptin | ChEMBL |