EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O2 |
| Net Charge | 0 |
| Average Mass | 298.426 |
| Monoisotopic Mass | 298.19328 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C(C)[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C20H26O2/c1-12-10-14(21)11-13-4-5-15-16-6-7-18(22)19(16,2)9-8-17(15)20(12,13)3/h10-11,15-17H,4-9H2,1-3H3/t15-,16-,17-,19-,20-/m0/s1 |
| InChIKey | PEPMWUSGRKINHX-TXTPUJOMSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atamestane (CHEBI:751732) has role androgen (CHEBI:50113) |
| atamestane (CHEBI:751732) has role antineoplastic agent (CHEBI:35610) |
| atamestane (CHEBI:751732) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| atamestane | WHO MedNet |
| atamestano | WHO MedNet |
| Synonym | Source |
|---|---|
| SH-489 | ChEMBL |