EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3N.C7H6O2 |
| Net Charge | 0 |
| Average Mass | 139.154 |
| Monoisotopic Mass | 139.06333 |
| SMILES | N.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.H3N/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);1H3 |
| InChIKey | VWSRWGFGAAKTQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammonium benzoate (CHEBI:751723) is a benzoic acids (CHEBI:22723) |
| Synonyms | Source |
|---|---|
| Ammonium benzoate | ChEMBL |
| Ammonium benzoicum | ChEMBL |
| NSC-7918 | ChEMBL |