EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@@]12CCC3=C(O)C(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H26O3/c1-18-10-8-15(20)17(22)14(18)4-3-11-12-5-6-16(21)19(12,2)9-7-13(11)18/h11-13,22H,3-10H2,1-2H3/t11-,12-,13-,18+,19-/m0/s1 |
| InChIKey | OSVMTWJCGUFAOD-KZQROQTASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| formestane (CHEBI:75172) has parent hydride androstane (CHEBI:35509) |
| formestane (CHEBI:75172) has role antineoplastic agent (CHEBI:35610) |
| formestane (CHEBI:75172) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| formestane (CHEBI:75172) is a 17-oxo steroid (CHEBI:19168) |
| formestane (CHEBI:75172) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| formestane (CHEBI:75172) is a enol (CHEBI:33823) |
| formestane (CHEBI:75172) is a hydroxy steroid (CHEBI:35350) |
| IUPAC Name |
|---|
| 4-hydroxyandrost-4-ene-3,17-dione |
| INNs | Source |
|---|---|
| formestane | WHO MedNet |
| formestane | ChemIDplus |
| formestano | WHO MedNet |
| formestanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-hydroxy-4-androstene-3,17-dione | ChemIDplus |
| 4-hydroxyandrostenedione | ChemIDplus |
| 4-hydroxy-Δ4-androstenedione | ChEBI |
| 4-OH-A | ChemIDplus |
| 4-OHAD | ChEBI |
| CGP 32349 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1238 | DrugCentral |
| D07260 | KEGG DRUG |
| DB08905 | DrugBank |
| Formestane | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4198373 | Reaxys |
| CAS:566-48-3 | ChemIDplus |
| Citations |
|---|