EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C28H29NO4S |
| Net Charge | 0 |
| Average Mass | 512.071 |
| Monoisotopic Mass | 511.15841 |
| SMILES | COc1ccc(-c2sc3cc(O)ccc3c2Oc2ccc(OCCN3CCCCC3)cc2)cc1.Cl |
| InChI | InChI=1S/C28H29NO4S.ClH/c1-31-22-8-5-20(6-9-22)28-27(25-14-7-21(30)19-26(25)34-28)33-24-12-10-23(11-13-24)32-18-17-29-15-3-2-4-16-29;/h5-14,19,30H,2-4,15-18H2,1H3;1H |
| InChIKey | NHSNLUIMAQQXGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arzoxifene hydrochloride (CHEBI:751710) has role antineoplastic agent (CHEBI:35610) |
| arzoxifene hydrochloride (CHEBI:751710) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Arzoxifene hcl | ChEMBL |
| Arzoxifene hydrochloride | ChEMBL |
| LY-353381.HCL | ChEMBL |
| LY353381.HCL | ChEMBL |
| SERM 3 | ChEMBL |
| SERM-3 | ChEMBL |