EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H46O14 |
| Net Charge | 0 |
| Average Mass | 690.739 |
| Monoisotopic Mass | 690.28876 |
| SMILES | C=C(CC[C@]12O[C@H](C(=O)O)[C@@](O)(C(=O)O)[C@](C(=O)O)(O1)[C@H](OC(=O)/C=C/[C@@H](C)C[C@@H](C)CC)[C@H]2O)[C@@H](OC(C)=O)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C35H46O14/c1-7-19(2)17-20(3)13-14-25(37)47-28-27(38)33(48-29(30(39)40)34(45,31(41)42)35(28,49-33)32(43)44)16-15-21(4)26(46-23(6)36)22(5)18-24-11-9-8-10-12-24/h8-14,19-20,22,26-29,38,45H,4,7,15-18H2,1-3,5-6H3,(H,39,40)(H,41,42)(H,43,44)/b14-13+/t19-,20+,22+,26+,27+,28+,29+,33-,34+,35-/m0/s1 |
| InChIKey | DFKDOZMCHOGOBR-NCSQYGPNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 2.5.1.21 (squalene synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of squalene synthase (EC 2.5.1.21). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zaragozic acid A (CHEBI:75170) has role EC 2.5.1.21 (squalene synthase) inhibitor (CHEBI:75174) |
| zaragozic acid A (CHEBI:75170) has role fungal metabolite (CHEBI:76946) |
| zaragozic acid A (CHEBI:75170) is a acetate ester (CHEBI:47622) |
| zaragozic acid A (CHEBI:75170) is a cyclic ketal (CHEBI:59779) |
| zaragozic acid A (CHEBI:75170) is a oxabicycloalkane (CHEBI:46733) |
| zaragozic acid A (CHEBI:75170) is a polyketide (CHEBI:26188) |
| zaragozic acid A (CHEBI:75170) is a tertiary alcohol (CHEBI:26878) |
| zaragozic acid A (CHEBI:75170) is a tricarboxylic acid (CHEBI:27093) |
| Incoming Relation(s) |
| zaragozic acid A derivative (CHEBI:83961) has functional parent zaragozic acid A (CHEBI:75170) |
| Synonyms | Source |
|---|---|
| 1S-((4S-acetoxy-5R-methyl-3-methylene-6-phenylhexyl)-6-(E)-4S,6S-dimethyloct-2-enoyloxy)-4,7S-dihydroxy-2,8-dioxabicyclo[3.2.1]octane-3S,4S,5R-tricarboxylic acid | LIPID MAPS |
| Squalestatin 1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK00000001 | LIPID MAPS |
| Zaragozic_acid | Wikipedia |
| ZGA | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5848265 | Reaxys |
| CAS:142561-96-4 | ChemIDplus |
| Citations |
|---|