EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H43N5O5 |
| Net Charge | 0 |
| Average Mass | 589.737 |
| Monoisotopic Mass | 589.32642 |
| SMILES | [H][C@@]12Cc3c(C)nc4cccc(c34)C1=C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](CC(C)C)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C33H43N5O5/c1-17(2)13-26-30(40)37-12-8-11-27(37)33(42)38(26)31(41)32(43-33,18(3)4)35-29(39)20-14-23-21-9-7-10-24-28(21)22(19(5)34-24)15-25(23)36(6)16-20/h7,9-10,14,17-18,20,25-27,34,42H,8,11-13,15-16H2,1-6H3,(H,35,39)/t20-,25-,26+,27+,32-,33+/m1/s1 |
| InChIKey | AFFLEALSHYGOOD-NOURLPFCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mergocriptine (CHEBI:751669) is a peptide ergot alkaloid (CHEBI:25904) |
| INNs | Source |
|---|---|
| mergocriptina | WHO MedNet |
| mergocriptine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-methyl-.alpha.-ergocryptine | ChEMBL |
| Cbm 36-733 | ChEMBL |
| Cbm36-733 | ChEMBL |