EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:75165 |
| ChEBI Name | dT(6-4)T |
| Stars | |
| Definition | A single-stranded DNA oligonucleotide consisting of two thymidine molecules linked (3'→5') and also with a C6-C4 bond. It results from irradiation at 254 nm of normal dTpT (PDB entry: 1EHL). |
| Last Modified | 9 December 2019 |
| Submitter | Marcus Ennis |
| Downloads |
| Formula | C20H27N4O12P |
| Net Charge | 0 |
| Average Mass | 546.426 |
| Monoisotopic Mass | 546.13631 |
| SMILES | [H][C@@]12c3nc(=O)n(cc3C)[C@H]3C[C@H](O)[C@@H](COP(=O)(O)O[C@H]4C[C@@H](O[C@@H]4CO)N1C(=O)NC(=O)[C@]2(C)O)O3 |
| InChI | InChI=1S/C20H27N4O12P/c1-8-5-23-13-3-9(26)12(35-13)7-33-37(31,32)36-10-4-14(34-11(10)6-25)24-16(15(8)21-18(23)28)20(2,30)17(27)22-19(24)29/h5,9-14,16,25-26,30H,3-4,6-7H2,1-2H3,(H,31,32)(H,22,27,29)/t9-,10-,11+,12+,13+,14+,16-,20+/m0/s1 |
| InChIKey | PRFQJBLUTUYASX-IWBSTULPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dT(6-4)T (CHEBI:75165) is a single-stranded DNA oligonucleotide (CHEBI:75153) |
| Incoming Relation(s) |
| thymidine(6-4)thymidine(2−) residue (CHEBI:145571) has functional parent dT(6-4)T (CHEBI:75165) |
| Synonyms | Source |
|---|---|
| 5'-(d(5ht)p*(6-4)t)-3' | ChEBI |
| D(5HT)(6-4)T | ChEBI |
| Citations |
|---|