EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H29ClN6O3 |
| Net Charge | 0 |
| Average Mass | 605.098 |
| Monoisotopic Mass | 604.19897 |
| SMILES | CCOC(=O)C1=C(c2ccc(-n3c(C)nc4cnccc43)cc2)NC(C)=C(C(=O)Nc2ccccn2)[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C34H29ClN6O3/c1-4-44-34(43)31-30(24-9-5-6-10-25(24)35)29(33(42)40-28-11-7-8-17-37-28)20(2)38-32(31)22-12-14-23(15-13-22)41-21(3)39-26-19-36-18-16-27(26)41/h5-19,30,38H,4H2,1-3H3,(H,37,40,42)/t30-/m1/s1 |
| InChIKey | ODRYSCQFUGFOSU-SSEXGKCCSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| modipafant (CHEBI:751642) has functional parent cinnamic acid (CHEBI:27386) |
| modipafant (CHEBI:751642) has role antiviral agent (CHEBI:22587) |
| modipafant (CHEBI:751642) is a olefinic compound (CHEBI:78840) |
| INN | Source |
|---|---|
| modipafant | WHO MedNet |
| Synonym | Source |
|---|---|
| UK-80067 | ChEMBL |