EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cl.C23H25N6O8S3 |
| Net Charge | 0 |
| Average Mass | 645.141 |
| Monoisotopic Mass | 644.05845 |
| SMILES | [Cl-].[H][C@@]12[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c3csc(N)n3)C(=O)N1C(C(=O)O)=C(CSc1cc[n+](C)cc1)C[S+]2[O-] |
| InChI | InChI=1S/C23H24N6O8S3.ClH/c1-23(2,21(34)35)37-27-14(13-9-39-22(24)25-13)17(30)26-15-18(31)29-16(20(32)33)11(10-40(36)19(15)29)8-38-12-4-6-28(3)7-5-12;/h4-7,9,15,19H,8,10H2,1-3H3,(H4-,24,25,26,30,32,33,34,35);1H/b27-14-;/t15-,19-,40?;/m1./s1 |
| InChIKey | WYKASFRWOOMFNP-ZISBYHFMSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefmepidium chloride (CHEBI:751637) is a cephalosporin (CHEBI:23066) |
| INNs | Source |
|---|---|
| cefmepidium chloride | WHO MedNet |
| chlorure de cefmepidium | WHO MedNet |
| cloruro de cefmepidio | WHO MedNet |