EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C12H21NO5 |
| Net Charge | 0 |
| Average Mass | 295.763 |
| Monoisotopic Mass | 295.11865 |
| SMILES | Cl.[H][C@]12[C@@H](O)CCN1C[C@H](OC(=O)CCC)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C12H21NO5.ClH/c1-2-3-9(15)18-8-6-13-5-4-7(14)10(13)12(17)11(8)16;/h7-8,10-12,14,16-17H,2-6H2,1H3;1H/t7-,8-,10+,11+,12+;/m0./s1 |
| InChIKey | KXNZMBFOWDNCRU-QVMZSJACSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celgosivir hydrochloride (CHEBI:751632) has role anti-HIV agent (CHEBI:64946) |
| celgosivir hydrochloride (CHEBI:751632) is a indolizines (CHEBI:38485) |
| Synonyms | Source |
|---|---|
| Celgosivir hcl | ChEMBL |
| Celgosivir hydrochloride | ChEMBL |
| MDL 28,574A | ChEMBL |
| MDL-28574A | ChEMBL |