EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O.C19H22N2O.H2O4S |
| Net Charge | 0 |
| Average Mass | 686.875 |
| Monoisotopic Mass | 686.31381 |
| SMILES | O=S(=O)(O)O.[H][C@@]12CCN(C[C@@H]1C=C)[C@@]([H])([C@@H](O)c1ccnc3ccccc13)C2.[H][C@@]12CCN(C[C@@H]1C=C)[C@@]([H])([C@@H](O)c1ccnc3ccccc13)C2 |
| InChI | InChI=1S/2C19H22N2O.H2O4S/c2*1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;1-5(2,3)4/h2*2-7,9,13-14,18-19,22H,1,8,10-12H2;(H2,1,2,3,4)/t2*13-,14-,18+,19-;/m00./s1 |
| InChIKey | WBBHOISPYYYBTC-SJFRDBBCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinchonine sulfate (CHEBI:751622) is a cinchona alkaloid (CHEBI:51323) |
| Synonyms | Source |
|---|---|
| Anhydrous cinchonine sulfate | ChEMBL |
| Cinchonine sulfate | ChEMBL |
| Cinchonine, sulfate (2:1) (salt) | ChEMBL |
| Cinchonine sulfate anhydrous | ChEMBL |
| Cinchonine sulfate, anhydrous | ChEMBL |
| Cinchonine sulphate | ChEMBL |