EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H37ClN2O8 |
| Net Charge | 0 |
| Average Mass | 613.107 |
| Monoisotopic Mass | 612.22384 |
| SMILES | [H][C@]12C[C@@H](OC(=O)c3cc(OC)c(OC)c(OC)c3)[C@H](OC)[C@@H](C(=O)OC)[C@@]1([H])C[C@]1([H])c3nc4ccc(Cl)cc4c3CCN1C2 |
| InChI | InChI=1S/C32H37ClN2O8/c1-38-24-10-16(11-25(39-2)29(24)40-3)31(36)43-26-12-17-15-35-9-8-19-21-13-18(33)6-7-22(21)34-28(19)23(35)14-20(17)27(30(26)41-4)32(37)42-5/h6-7,10-11,13,17,20,23,26-27,30,34H,8-9,12,14-15H2,1-5H3/t17-,20+,23-,26-,27+,30+/m1/s1 |
| InChIKey | FQUMWACBNIURCJ-RWZVGCGMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloroserpidine (CHEBI:751614) is a alkaloid (CHEBI:22315) |
| INNs | Source |
|---|---|
| chloroserpidine | WHO MedNet |
| cloroserpidina | WHO MedNet |