EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O4.C18H26ClN3O3 |
| Net Charge | 0 |
| Average Mass | 485.965 |
| Monoisotopic Mass | 485.19288 |
| SMILES | COCCCN1CCC(NC(=O)c2cc(Cl)c(N)c3c2OCC3)CC1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C18H26ClN3O3.C4H6O4/c1-24-9-2-6-22-7-3-12(4-8-22)21-18(23)14-11-15(19)16(20)13-5-10-25-17(13)14;5-3(6)1-2-4(7)8/h11-12H,2-10,20H2,1H3,(H,21,23);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | QZRSNVSQLGRAID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prucalopride succinate (CHEBI:751603) has role laxative (CHEBI:50503) |
| prucalopride succinate (CHEBI:751603) is a 1-benzofurans (CHEBI:38830) |
| Synonyms | Source |
|---|---|
| Prucalopride (as succinate) | ChEMBL |
| R-108512 | ChEMBL |
| Brand Name | Source |
|---|---|
| Motegrity | ChEMBL |