EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N2O2.CH3O4S |
| Net Charge | 0 |
| Average Mass | 334.394 |
| Monoisotopic Mass | 334.11986 |
| SMILES | CN(C)C(=O)Oc1cccc([N+](C)(C)C)c1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H19N2O2.CH4O4S/c1-13(2)12(15)16-11-8-6-7-10(9-11)14(3,4)5;1-5-6(2,3)4/h6-9H,1-5H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | OSZNNLWOYWAHSS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neostigmine methyl sulfate (CHEBI:7516) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| neostigmine methyl sulfate (CHEBI:7516) is a arylammonium sulfate salt (CHEBI:38018) |
| Synonyms | Source |
|---|---|
| Intrastigmina | ChEMBL |
| neostigmine methylsulfate | ChEMBL |
| Neostigmine methyl sulfate | ChEMBL |
| Neostigmine methylsulfate | KEGG COMPOUND |
| Neostigmine methylsulphate | ChEMBL |
| Neostigmine metilsulfate | ChEMBL |
| Brand Names | Source |
|---|---|
| Bloxiverz | ChEMBL |
| Neostigmine methylsulfate component of prevduo | ChEMBL |
| Robinul-neostig | ChEMBL |
| Citations |
|---|