EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O4P.C19H18FN3O |
| Net Charge | 0 |
| Average Mass | 421.365 |
| Monoisotopic Mass | 421.12029 |
| SMILES | CNCc1ccc(-c2nc3cc(F)cc4c3c2CCNC4=O)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C19H18FN3O.H3O4P/c1-21-10-11-2-4-12(5-3-11)18-14-6-7-22-19(24)15-8-13(20)9-16(23-18)17(14)15;1-5(2,3)4/h2-5,8-9,21,23H,6-7,10H2,1H3,(H,22,24);(H3,1,2,3,4) |
| InChIKey | FCCGJTKEKXUBFZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rucaparib phosphate (CHEBI:751597) has role antineoplastic agent (CHEBI:35610) |
| rucaparib phosphate (CHEBI:751597) is a benzazepine (CHEBI:35676) |
| Synonyms | Source |
|---|---|
| Ag 014699 | ChEMBL |
| AG-014699 | ChEMBL |
| AG014699 | ChEMBL |
| AG-14699 | ChEMBL |
| PF-01367338 | ChEMBL |
| PF01367338 | ChEMBL |
| Citations |
|---|