EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22FN3O5 |
| Net Charge | 0 |
| Average Mass | 415.421 |
| Monoisotopic Mass | 415.15435 |
| SMILES | CC(C)[C@@]1(C(=O)N[C@H]2CC(=O)O[C@]2(O)CF)CC(c2nccc3ccccc23)=NO1 |
| InChI | InChI=1S/C21H22FN3O5/c1-12(2)20(19(27)24-16-9-17(26)29-21(16,28)11-22)10-15(25-30-20)18-14-6-4-3-5-13(14)7-8-23-18/h3-8,12,16,28H,9-11H2,1-2H3,(H,24,27)/t16-,20+,21+/m0/s1 |
| InChIKey | VYFGDLGHHBUDTQ-ZLGUVYLKSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nivocasan (CHEBI:751593) has role antiviral agent (CHEBI:22587) |
| nivocasan (CHEBI:751593) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| nivocasan | WHO MedNet |
| Synonyms | Source |
|---|---|
| GS-9450 | ChEMBL |
| LB-84451 | ChEMBL |
| LB84451 | ChEMBL |